Hello, Welcome to Chemicalbridge
| Pack Size | Availability | Purity | Price |
|---|---|---|---|
| 5ml | 2 -3 weeks | 96%+,stabilized with MEHQ | |
| 25ml | 2 -3 weeks | 96%+,stabilized with MEHQ | |
| 100ml | 2 -3 weeks | 96%+,stabilized with MEHQ |
| Transport Condition | 2-8℃ |
|---|---|
| Storage Temp. | 2-8℃ |
| GHS Pictogram |  |
| Hazard category | - |
| Biological Activity | |
| Character | |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Risk Statements | H302-H315-H319-H335 |
| Flash Point | |
| Safety Statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | Warning |
|---|---|
| InchiKey | UJRIYYLGNDXVTA-UHFFFAOYSA-N |
| Canonical Smiles | CCCCCCCCCCCCCCCC(=O)OC=C |
| Inchi | InChI=1S/C18H34O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20-4-2/h4H,2-3,5-17H2,1H3 |
| Density | |
| MDL No. | MFCD00059288 |
| Water Solubility | |
| Exact Mass | 282.25588 |
| Chirality | |
| GHS | |
| Cas No. | 693-38-9 |
| Chemical Name | Vinyl Palmitate |
| UN No. | - |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
