Hello, Welcome to Chemicalbridge
| Pack Size | Availability | Purity | Price |
|---|---|---|---|
|
Sorry, there is no price information yet |
|||
| Transport Condition | -20°C |
|---|---|
| Storage Temp. | -20°C, sealed storage, away from moisture and light |
| GHS Pictogram |  |
| Hazard category | |
| Biological Activity | |
| Character | |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Risk Statements | H302-H315-H319-H335 |
| Flash Point | |
| Safety Statements | P261-P264-P270-P271-P280-P302+P352-P304+P340-P305+P351+P338-P330-P362-P403+P233-P405-P501 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | |
|---|---|
| InchiKey | GKPKAXNMDLEJIG-UHFFFAOYSA-N |
| Canonical Smiles | COC(=O)C1C=C(Cl)N=NC=1N |
| Inchi | InChI=1S/C6H6ClN3O2/c1-12-6(11)3-2-4(7)9-10-5(3)8/h2H,1H3,(H2,8,10) |
| Density | |
| MDL No. | |
| Water Solubility | |
| Exact Mass | 187.01485 |
| Chirality | |
| GHS | |
| Cas No. | 1784117-49-2 |
| Chemical Name | Methyl 3-amino-6-chloropyridazine-4-carboxylate |
| UN No. |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
